Products 851335-07-4
CAS 851335-07-4 appears in our catalog under these names: 4-Borono-3-fluorobenzoic acid 97%, 4-Carboxy-2-fluorophenylboronic acid, 97%, 4-Borono-3-fluorobenzoic acid, 97%, 97%, 4–Carboxy–2–fluorophenylboronic Acid (contains varying amounts of Anhydride), 4-Carboxy-2-fluorophenylboronic Acid (contains varying amounts of Anhydride). Offered by: Ambeed, Fluorochem, Chemat, GLPBio, TCI. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g.
4-borono-3-fluorobenzoic acid (CAS 851335-07-4) is a chemical compound with the molecular formula C7H6BFO4 and a molecular weight of 183.93 g/mol. IUPAC name: 4-borono-3-fluorobenzoic acid. InChIKey: TVNVDRMGOOLVOX-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO4 |
|---|---|
| Molecular weight | 183.93 g/mol |
| IUPAC name | 4-borono-3-fluorobenzoic acid |
| InChIKey | TVNVDRMGOOLVOX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)O)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(dihydroxyboranyl)-3-fluorobenzoic acid, 4-borono-3-fluorobenzoic acid, 4-Carboxy-2-fluorobenzeneboronic acid, Benzoic acid, 4-borono-3-fluoro-, 4-Borono-3-fluoro-benzoic acid, 4-borono-3-fluorobenzoicacid, 4-carboxy-2-fluorobezeneboronic acid, 4-Carboxy-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), TVNVDRMGOOLVOX-UHFFFAOYSA-N, 2-fluoro-4-carboxyphenylboronic acid