CAS 874219-59-7 appears in our catalog under these names: 2–Fluoro–5–carboxybenzeneboronic acid, 96%, 5-Carboxy-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), 3-Borono-4-fluorobenzoic acid 96%, 3-Borono-4-Fluorobenzoic Acid, 98%, 98%, 5-Carboxy-2-fluorophenylboronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
3-borono-4-fluorobenzoic acid (CAS 874219-59-7) is a chemical compound with the molecular formula C7H6BFO4 and a molecular weight of 183.93 g/mol. IUPAC name: 3-borono-4-fluorobenzoic acid. InChIKey: YLZPFWJYAFZZHF-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO4 |
|---|---|
| Molecular weight | 183.93 g/mol |
| IUPAC name | 3-borono-4-fluorobenzoic acid |
| InChIKey | YLZPFWJYAFZZHF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)O)F)(O)O |
Computed by PubChem (NCBI)