Products 872460-12-3
CAS 872460-12-3 appears in our catalog under these names: 3-Carboxy-4-fluorophenylboronic Acid 98%, 3-Carboxy-4-fluorophenylboronic acid, 97%, 3–Carboxy–4–fluorophenylboronic acid（contains varying amounts of Anhydride）, 3-Carboxy-4-fluorophenylboronic Acid (contains varying amounts of Anhydride), 5-Borono-2-fluorobenzoic acid, 98%, 98%. Offered by: Ambeed, Fluorochem, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 10g.
5-borono-2-fluorobenzoic acid (CAS 872460-12-3) is a chemical compound with the molecular formula C7H6BFO4 and a molecular weight of 183.93 g/mol. IUPAC name: 5-borono-2-fluorobenzoic acid. InChIKey: DGORTXQWDDXSIQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO4 |
|---|---|
| Molecular weight | 183.93 g/mol |
| IUPAC name | 5-borono-2-fluorobenzoic acid |
| InChIKey | DGORTXQWDDXSIQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Carboxy-4-fluorophenylboronic acid, 5-borono-2-fluorobenzoic acid, 3-Carboxy-4-fluorobenzeneboronic acid, 4-fluoro-3-carboxyphenylboronic acid, 3-Carboxy-4-fluorophenylboronicacid, 5-(dihydroxyboranyl)-2-fluorobenzoic acid, 5-borono-2-fluoro-benzoic Acid, Benzoic acid, 5-borono-2-fluoro-, Intermediate Impurity 37, 5-(dihydroxyboryl)-2-fluorobenzoic acid