3-Chloro-1-(2-fluorophenyl)-1-propanone, 98%
cas: 898767-04-9 — see every product listed under this CAS number, including other names
3-Chloro-1-(2-fluorophenyl)-1-propanone, 98% (CAS 898767-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A389228-250mg |
| cas | 898767-04-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1104.63 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 875.60 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 386.56 Pln | |
| BLDpharm | 5g | 1180.72 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3-chloro-1-(2-fluorophenyl)propan-1-one (CAS 898767-04-9) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 3-chloro-1-(2-fluorophenyl)propan-1-one. InChIKey: WCNSDVGUYXGZDE-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 3-chloro-1-(2-fluorophenyl)propan-1-one |
| InChIKey | WCNSDVGUYXGZDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CCCl)F |
Computed by PubChem (NCBI)