cas: 80563-86-6 — see every product listed under this CAS number, including other names
3-Chloro-2-methylbenzene-1-sulfonyl chloride 98% (CAS 80563-86-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148167-5g |
| cas | 80563-86-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 342.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148167 |
3-chloro-2-methylbenzenesulfonyl chloride (CAS 80563-86-6) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 3-chloro-2-methylbenzenesulfonyl chloride. InChIKey: ZSIYKAQPQRTBPF-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 3-chloro-2-methylbenzenesulfonyl chloride |
| InChIKey | ZSIYKAQPQRTBPF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)