CAS 155814-22-5 appears in our catalog under these names: 3–Chloro–4–fluorocinnamic acid, 3-Chloro-4-fluorocinnamic acid, 97% (E), 97% (E), 3-Chloro-4-fluorocinnamic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoic acid (CAS 155814-22-5) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoic acid. InChIKey: OYFKFZBXVYKVCD-DUXPYHPUSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoic acid |
| InChIKey | OYFKFZBXVYKVCD-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)Cl)F |
Computed by PubChem (NCBI)