cas: 37908-96-6 — see every product listed under this CAS number, including other names
3-Chloro-4-methoxybenzoic acid 98% (CAS 37908-96-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143881-1g |
| cas | 37908-96-6 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 1076.81 Pln | |
| Ambeed | 500g | 5048.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A143881 |
3-chloro-4-methoxybenzoic acid (CAS 37908-96-6) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 3-chloro-4-methoxybenzoic acid. InChIKey: IBCQUQXCTOPJOD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 3-chloro-4-methoxybenzoic acid |
| InChIKey | IBCQUQXCTOPJOD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)