CAS 37908-96-6 appears in our catalog under these names: 3–Chloro–4–Methoxybenzoic Acid, 3-Chloro-4-methoxybenzoic acid/ 98+%, 3-Chloro-4-methoxybenzoic acid, 98+% , 3-Chloro-4-methoxybenzoic Acid, >97.0%(GC)(T), 3-Chloro-4-methoxybenzoic acid. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 100g, 10g, 25g, 500g, 5g, 50g, 1g.
3-chloro-4-methoxybenzoic acid (CAS 37908-96-6) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 3-chloro-4-methoxybenzoic acid. InChIKey: IBCQUQXCTOPJOD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 3-chloro-4-methoxybenzoic acid |
| InChIKey | IBCQUQXCTOPJOD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)