cas: 42413-03-6 — see every product listed under this CAS number, including other names
3-Chloro-4-methylbenzene-1-sulfonyl chloride, 97% (CAS 42413-03-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | TL00685DA |
| cas | 42413-03-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 108.94 Pln | |
| Thermo Scientific | 10g | 436.79 Pln | |
| Thermo Scientific | 25g | 865.44 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-chloro-4-methylbenzenesulfonyl chloride (CAS 42413-03-6) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 3-chloro-4-methylbenzenesulfonyl chloride. InChIKey: GNYVVCRRZRVBDD-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 3-chloro-4-methylbenzenesulfonyl chloride |
| InChIKey | GNYVVCRRZRVBDD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)