3-Chloro-4-phenylbenzeneboronic acid, 95%
cas: 179381-09-0 — see every product listed under this CAS number, including other names
3-Chloro-4-phenylbenzeneboronic acid, 95% (CAS 179381-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1042316-100mg |
| cas | 179381-09-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1082.38 Pln | |
| Ambeed | 5g | 3607.75 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 447.64 Pln | |
| BLDpharm | 1g | 1064.09 Pln | |
| BLDpharm | 5g | 3541.00 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 294.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3-chloro-4-phenylphenyl)boronic acid (CAS 179381-09-0) is a chemical compound with the molecular formula C12H10BClO2 and a molecular weight of 232.47 g/mol. IUPAC name: (3-chloro-4-phenylphenyl)boronic acid. InChIKey: YJSVAFMGMDUPBB-UHFFFAOYSA-N.
| Molecular formula | C12H10BClO2 |
|---|---|
| Molecular weight | 232.47 g/mol |
| IUPAC name | (3-chloro-4-phenylphenyl)boronic acid |
| InChIKey | YJSVAFMGMDUPBB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=CC=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)