Products 1186403-21-3
CAS 1186403-21-3 is the registry number for 5-Chlorobiphenyl-3-ylboronic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
(3-chloro-5-phenylphenyl)boronic acid (CAS 1186403-21-3) is a chemical compound with the molecular formula C12H10BClO2 and a molecular weight of 232.47 g/mol. IUPAC name: (3-chloro-5-phenylphenyl)boronic acid. InChIKey: GUHOEUKIARFGPP-UHFFFAOYSA-N.
| Molecular formula | C12H10BClO2 |
|---|---|
| Molecular weight | 232.47 g/mol |
| IUPAC name | (3-chloro-5-phenylphenyl)boronic acid |
| InChIKey | GUHOEUKIARFGPP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Chlorobiphenyl-3-ylboronic acid, (5-Chloro-[1,1'-biphenyl]-3-yl)boronic acid, B-(5-Chloro[1,1'-biphenyl]-3-yl)boronic acid, (5-chloro-biphenyl-3-yl)boronic acid, {5-chloro-[1,1'-biphenyl]-3-yl}boronic acid, (3-chloro-5-phenylphenyl)boronic acid, 5-Chloro-3-biphenylboronic acid, 5-Chlorobiphenyl-3-boronic Acid, 5-Chlorobiphenyl-3-ylboronicacid, (5-Chloro-3-biphenylyl)boronic acid