Products 364044-44-0
CAS 364044-44-0 appears in our catalog under these names: 4'-Chloro-4-biphenylboronic acid, 98%, 4'–Chloro–4–biphenylboronic Acid (contains varying amounts of Anhydride), 4'-Chloro-4-biphenylboronic Acid (contains varying amounts of Anhydride), 4'-Chloro-4-biphenylboronic acid, 97%. Offered by: Combi-blocks, GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 500g.
[4-(4-chlorophenyl)phenyl]boronic acid (CAS 364044-44-0) is a chemical compound with the molecular formula C12H10BClO2 and a molecular weight of 232.47 g/mol. IUPAC name: [4-(4-chlorophenyl)phenyl]boronic acid. InChIKey: FVKZNRXWZCBUPY-UHFFFAOYSA-N.
| Molecular formula | C12H10BClO2 |
|---|---|
| Molecular weight | 232.47 g/mol |
| IUPAC name | [4-(4-chlorophenyl)phenyl]boronic acid |
| InChIKey | FVKZNRXWZCBUPY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4'-Chloro-4-biphenylboronic Acid (contains varying amounts of Anhydride), [4-(4-chlorophenyl)phenyl]boronic acid, C12H10BClO2, (4'-Chloro[1,1'-biphenyl]-4-yl)boronic acid, 4'-Chloro-biphenyl-4-boronic acid, Boronic acid, (4'-chloro[1,1'-biphenyl]-4-yl)-, FVKZNRXWZCBUPY-UHFFFAOYSA-N, 4'-chlorobiphenyl-4-ylboronic acid, 4-(4-chlorophenyl)phenylboronic acid, (4'-Chloro-4-biphenylyl)boronic acid