Products 1025496-32-5
CAS 1025496-32-5 is the registry number for (3'-Chloro-[1,1'-biphenyl]-4-yl)boronic acid, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[4-(3-chlorophenyl)phenyl]boronic acid (CAS 1025496-32-5) is a chemical compound with the molecular formula C12H10BClO2 and a molecular weight of 232.47 g/mol. IUPAC name: [4-(3-chlorophenyl)phenyl]boronic acid. InChIKey: MHTJADAVSSOHSH-UHFFFAOYSA-N.
| Molecular formula | C12H10BClO2 |
|---|---|
| Molecular weight | 232.47 g/mol |
| IUPAC name | [4-(3-chlorophenyl)phenyl]boronic acid |
| InChIKey | MHTJADAVSSOHSH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC(=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3'-chlorobiphenyl-4-boronic acid, [4-(3-chlorophenyl)phenyl]boronic acid, (3'-Chloro-[1,1'-biphenyl]-4-yl)boronic acid, Boronic acid, B-(3'-chloro[1,1'-biphenyl]-4-yl)-, 3'-Chlorobiphenyl-4-boronicAcid, 3''-Chlorobiphenyl-4-boronic Acid, (3'-Chloro[1,1'-biphenyl]-4-yl)boronic acid, B-(3'-Chloro[1,1'-biphenyl]-4-yl)boronic acid, {3''-chloro-[1,1''-biphenyl]-4-yl}boronic acid, 3 inverted exclamation mark -Chlorobiphenyl-4-boronic Acid