CAS 2607747-79-3 appears in our catalog under these names: (6-Chloro-[1,1'-biphenyl]-2-yl)boronic acid, 95%, B-(6-Chloro[1,1′-biphenyl]-2-yl)boronic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
(3-chloro-2-phenylphenyl)boronic acid (CAS 2607747-79-3) is a chemical compound with the molecular formula C12H10BClO2 and a molecular weight of 232.47 g/mol. IUPAC name: (3-chloro-2-phenylphenyl)boronic acid. InChIKey: VHKPMRVHIANRJA-UHFFFAOYSA-N.
| Molecular formula | C12H10BClO2 |
|---|---|
| Molecular weight | 232.47 g/mol |
| IUPAC name | (3-chloro-2-phenylphenyl)boronic acid |
| InChIKey | VHKPMRVHIANRJA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)