Products 2226739-30-4
CAS 2226739-30-4 appears in our catalog under these names: (5-Chloro-[1,1'-biphenyl]-2-yl)boronic acid, 95%, 95%, (5-Chloro-[1,1'-biphenyl]-2-yl)boronic acid, 97%, (5-Chloro-[1,1'-biphenyl]-2-yl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.
(4-chloro-2-phenylphenyl)boronic acid (CAS 2226739-30-4) is a chemical compound with the molecular formula C12H10BClO2 and a molecular weight of 232.47 g/mol. IUPAC name: (4-chloro-2-phenylphenyl)boronic acid. InChIKey: USYCVMIVHUOLLP-UHFFFAOYSA-N.
| Molecular formula | C12H10BClO2 |
|---|---|
| Molecular weight | 232.47 g/mol |
| IUPAC name | (4-chloro-2-phenylphenyl)boronic acid |
| InChIKey | USYCVMIVHUOLLP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(5-chloro-[1,1'-biphenyl]-2-yl)boronic acid, 5-Chlorobiphenyl-2-boronic Acid, 5-chlorobiphenyl 2-boric acid, Boronic acid, B-(5-chloro[1,1'-biphenyl]-2-yl)-, B-(5-Chloro[1,1'-biphenyl]-2-yl)boronic acid, (5-Chloro-[1,1''-biphenyl]-2-yl)boronic acid, B-(5-chloro[1,1'-biphenyl]-2-yl)-Boronic acid