CAS 1058740-21-8 is the registry number for 3-Chloro-5-methoxybenzenesulfonyl chloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-chloro-5-methoxybenzenesulfonyl chloride (CAS 1058740-21-8) is a chemical compound with the molecular formula C7H6Cl2O3S and a molecular weight of 241.09 g/mol. IUPAC name: 3-chloro-5-methoxybenzenesulfonyl chloride. InChIKey: ACOLYCXJBCTGHZ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O3S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 3-chloro-5-methoxybenzenesulfonyl chloride |
| InChIKey | ACOLYCXJBCTGHZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)