Products 612541-13-6

CAS 612541-13-6 appears in our catalog under these names: 4-Chloro-2-methoxybenzene-1-sulfonyl chloride, 95+%, 4-Chloro-2-methoxybenzene-1-sulfonyl chloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.

4-chloro-2-methoxybenzenesulfonyl chloride (CAS 612541-13-6) is a chemical compound with the molecular formula C7H6Cl2O3S and a molecular weight of 241.09 g/mol. IUPAC name: 4-chloro-2-methoxybenzenesulfonyl chloride. InChIKey: JIFZOSWXWRNSFB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2O3S
Molecular weight241.09 g/mol
IUPAC name4-chloro-2-methoxybenzenesulfonyl chloride
InChIKeyJIFZOSWXWRNSFB-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)