Products 23094-94-2
CAS 23094-94-2 appears in our catalog under these names: 2-Chloro-4-methoxybenzene-1-sulfonyl chloride, 95%, 2-Chloro-4-methoxybenzene-1-sulfonyl chloride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-chloro-4-methoxybenzenesulfonyl chloride (CAS 23094-94-2) is a chemical compound with the molecular formula C7H6Cl2O3S and a molecular weight of 241.09 g/mol. IUPAC name: 2-chloro-4-methoxybenzenesulfonyl chloride. InChIKey: KVRCCIGDMLSANW-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O3S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 2-chloro-4-methoxybenzenesulfonyl chloride |
| InChIKey | KVRCCIGDMLSANW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)