CAS 20951-05-7 appears in our catalog under these names: 2,6-Dichloro-4-(methylsulfonyl)phenol, 95%, 2,6-Dichloro-4-(methylsulfonyl)phenol, 95.0%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
2,6-dichloro-4-methylsulfonylphenol (CAS 20951-05-7) is a chemical compound with the molecular formula C7H6Cl2O3S and a molecular weight of 241.09 g/mol. IUPAC name: 2,6-dichloro-4-methylsulfonylphenol. InChIKey: CTBGNTCBLZAIRI-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O3S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 2,6-dichloro-4-methylsulfonylphenol |
| InChIKey | CTBGNTCBLZAIRI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C(=C1)Cl)O)Cl |
Computed by PubChem (NCBI)