Products 491850-54-5
CAS 491850-54-5 appears in our catalog under these names: 2-Chloro-6-methoxybenzene-1-sulfonyl chloride, 95%, 2-Chloro-6-methoxybenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-6-methoxybenzenesulfonyl chloride (CAS 491850-54-5) is a chemical compound with the molecular formula C7H6Cl2O3S and a molecular weight of 241.09 g/mol. IUPAC name: 2-chloro-6-methoxybenzenesulfonyl chloride. InChIKey: COUJLCICQHFIKL-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O3S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 2-chloro-6-methoxybenzenesulfonyl chloride |
| InChIKey | COUJLCICQHFIKL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)