Products 201935-41-3

CAS 201935-41-3 appears in our catalog under these names: 2-Chloro-5-methoxybenzene-1-sulfonyl chloride, 95%, 2-Chloro-5-methoxybenzenesulfonyl chloride, 2-Chloro-5-methoxybenzene-1-sulfonyl chloride 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

2-chloro-5-methoxybenzenesulfonyl chloride (CAS 201935-41-3) is a chemical compound with the molecular formula C7H6Cl2O3S and a molecular weight of 241.09 g/mol. IUPAC name: 2-chloro-5-methoxybenzenesulfonyl chloride. InChIKey: MEAYPBQBXNTXBT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2O3S
Molecular weight241.09 g/mol
IUPAC name2-chloro-5-methoxybenzenesulfonyl chloride
InChIKeyMEAYPBQBXNTXBT-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)