cas: 19313-87-2 — see every product listed under this CAS number, including other names
3-Chloro-N-(4-methoxyphenyl)propanamide, 97%, 97% (CAS 19313-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APOU-100mg |
| cas | 19313-87-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 616.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-chloro-N-(4-methoxyphenyl)propanamide (CAS 19313-87-2) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 3-chloro-N-(4-methoxyphenyl)propanamide. InChIKey: ZVNNQFDBJXKWOE-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 3-chloro-N-(4-methoxyphenyl)propanamide |
| InChIKey | ZVNNQFDBJXKWOE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=O)CCCl |
Computed by PubChem (NCBI)