3-Cyano-5-fluorobenzene-1-sulfonyl chloride, 95%
cas: 1261644-49-8 — see every product listed under this CAS number, including other names
3-Cyano-5-fluorobenzene-1-sulfonyl chloride, 95% (CAS 1261644-49-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F695359-250MG |
| cas | 1261644-49-8 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 5g | 1575.50 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 754.19 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 264.38 Pln | |
| BLDpharm | 5g | 808.63 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1082.00 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3-cyano-5-fluorobenzenesulfonyl chloride (CAS 1261644-49-8) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 3-cyano-5-fluorobenzenesulfonyl chloride. InChIKey: ZQEROTOETXELJU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 3-cyano-5-fluorobenzenesulfonyl chloride |
| InChIKey | ZQEROTOETXELJU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)