Products 1261674-26-3
CAS 1261674-26-3 appears in our catalog under these names: 2-Cyano-4-fluorobenzene-1-sulfonyl chloride, 95%, 95%, 2-Cyano-4-fluorobenzene-1-sulfonyl chloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-cyano-4-fluorobenzenesulfonyl chloride (CAS 1261674-26-3) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 2-cyano-4-fluorobenzenesulfonyl chloride. InChIKey: KXWBPZIFIFCHHG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 2-cyano-4-fluorobenzenesulfonyl chloride |
| InChIKey | KXWBPZIFIFCHHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C#N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)