CAS 1101120-80-2 appears in our catalog under these names: 5-Cyano-2-fluorobenzene-1-sulfonyl chloride, 98%, 5-Cyano-2-fluorobenzene-1-sulfonyl chloride, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
5-cyano-2-fluorobenzenesulfonyl chloride (CAS 1101120-80-2) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 5-cyano-2-fluorobenzenesulfonyl chloride. InChIKey: XLPGJVFDGAPUIH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 5-cyano-2-fluorobenzenesulfonyl chloride |
| InChIKey | XLPGJVFDGAPUIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)