Products 1101120-80-2

CAS 1101120-80-2 appears in our catalog under these names: 5-Cyano-2-fluorobenzene-1-sulfonyl chloride, 98%, 5-Cyano-2-fluorobenzene-1-sulfonyl chloride, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.

Structural formula: {0} (CAS {1})

5-cyano-2-fluorobenzenesulfonyl chloride (CAS 1101120-80-2) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 5-cyano-2-fluorobenzenesulfonyl chloride. InChIKey: XLPGJVFDGAPUIH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClFNO2S
Molecular weight219.62 g/mol
IUPAC name5-cyano-2-fluorobenzenesulfonyl chloride
InChIKeyXLPGJVFDGAPUIH-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C#N)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)