Products 1261644-49-8
CAS 1261644-49-8 appears in our catalog under these names: 3–Cyano–5–fluorobenzene–1–sulfonyl chloride, 3-Cyano-5-fluorobenzene-1-sulfonyl chloride, 95%, 95%, 3-Cyano-5-fluorobenzene-1-sulfonyl chloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g.
3-cyano-5-fluorobenzenesulfonyl chloride (CAS 1261644-49-8) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 3-cyano-5-fluorobenzenesulfonyl chloride. InChIKey: ZQEROTOETXELJU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 3-cyano-5-fluorobenzenesulfonyl chloride |
| InChIKey | ZQEROTOETXELJU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)