CAS 918967-78-9 appears in our catalog under these names: 4-cyano-2-fluorobenzene-1-sulfonyl Chloride, 4-Cyano-2-fluorobenzene-1-sulfonyl chloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
4-cyano-2-fluorobenzenesulfonyl chloride (CAS 918967-78-9) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 4-cyano-2-fluorobenzenesulfonyl chloride. InChIKey: UYHVZXCIAQVHMY-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 4-cyano-2-fluorobenzenesulfonyl chloride |
| InChIKey | UYHVZXCIAQVHMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)