Products 918967-78-9

CAS 918967-78-9 appears in our catalog under these names: 4-cyano-2-fluorobenzene-1-sulfonyl Chloride, 4-Cyano-2-fluorobenzene-1-sulfonyl chloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.

Structural formula: {0} (CAS {1})

4-cyano-2-fluorobenzenesulfonyl chloride (CAS 918967-78-9) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 4-cyano-2-fluorobenzenesulfonyl chloride. InChIKey: UYHVZXCIAQVHMY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClFNO2S
Molecular weight219.62 g/mol
IUPAC name4-cyano-2-fluorobenzenesulfonyl chloride
InChIKeyUYHVZXCIAQVHMY-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C#N)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)