3-Ethoxycarbonylphenylboronic acid, 98%
cas: 4334-87-6 — see every product listed under this CAS number, including other names
3-Ethoxycarbonylphenylboronic acid, 98% (CAS 4334-87-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 10g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A141248-1g |
| cas | 4334-87-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 637.38 Pln | |
| Ambeed | 500g | 2890.19 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 477.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3-ethoxycarbonylphenyl)boronic acid (CAS 4334-87-6) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (3-ethoxycarbonylphenyl)boronic acid. InChIKey: REHVCPNQQBDOJJ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (3-ethoxycarbonylphenyl)boronic acid |
| InChIKey | REHVCPNQQBDOJJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-ethoxycarbonylphenyl)boronic Acid, 3-Ethoxycarbonylphenylboronic acid, 3-(Ethoxycarbonyl)phenylboronic acid, (3-(ethoxycarbonyl)phenyl)boronic acid, [3-(ethoxycarbonyl)phenyl]boronic acid, m-ethoxycarbonylphenylboronic acid, 3-Ethoxycarbonylbenzeneboronic acid, 3-(ethoxycarbonyl)phenyl boronic acid, 3-ethoxycarbonyl-phenylboronic acid, 3-(ethoxycarbonyl)benzeneboronic acid