CAS 4334-87-6 appears in our catalog under these names: 3–Ethoxycarbonylphenylboronic acid, 3-Ethoxycarbonylphenylboronic acid/ 95+%, 3-(Ethoxycarbonyl)benzeneboronic acid, 97% , 3-(Ethoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), 3-Ethoxycarbonylphenylboronic acid 98%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 100g, 500g, 10g, 25 g, 10 g.
(3-ethoxycarbonylphenyl)boronic acid (CAS 4334-87-6) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (3-ethoxycarbonylphenyl)boronic acid. InChIKey: REHVCPNQQBDOJJ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (3-ethoxycarbonylphenyl)boronic acid |
| InChIKey | REHVCPNQQBDOJJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)