cas: 403-21-4 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitrobenzoic acid, 97% (CAS 403-21-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013031-1G |
| cas | 403-21-4 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 513.38 Pln | |
| Fluorochem | 250g | 1106.92 Pln | |
| Fluorochem | 500g | 1981.61 Pln | |
| Fluorochem | 1kg | 3871.57 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
3-fluoro-4-nitrobenzoic acid (CAS 403-21-4) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 3-fluoro-4-nitrobenzoic acid. InChIKey: WVZBIQSKLXJFNX-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 3-fluoro-4-nitrobenzoic acid |
| InChIKey | WVZBIQSKLXJFNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)