CAS 1366234-02-7 appears in our catalog under these names: 5-Fluoro-6-nitrobenzo[d][1,3]dioxole, 95%, 5-Fluoro-6-nitrobenzo(d)(1,3)dioxole, 95%, 5-Fluoro-6-nitrobenzo[d][1,3]dioxo, >95%, >95%, 5-FLUORO-6-NITROBENZO[D][1,3]DIOXOLE. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
5-fluoro-6-nitro-1,3-benzodioxole (CAS 1366234-02-7) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 5-fluoro-6-nitro-1,3-benzodioxole. InChIKey: BFBIFECVIJIGQK-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 5-fluoro-6-nitro-1,3-benzodioxole |
| InChIKey | BFBIFECVIJIGQK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)