CAS 711022-47-8 appears in our catalog under these names: 3-Fluoro-4-hydroxy-5-nitrobenzaldehyde, 95%, 3-Fluoro-4-hydroxy-5-nitrobenzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g.
3-fluoro-4-hydroxy-5-nitrobenzaldehyde (CAS 711022-47-8) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 3-fluoro-4-hydroxy-5-nitrobenzaldehyde. InChIKey: CZOMOYVUYOVNHX-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 3-fluoro-4-hydroxy-5-nitrobenzaldehyde |
| InChIKey | CZOMOYVUYOVNHX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)F)C=O |
Computed by PubChem (NCBI)