Products 385-02-4
CAS 385-02-4 appears in our catalog under these names: 2–Fluoro–6–nitrobenzoic acid, 2-Fluoro-6-nitrobenzoic acid, 98% , 6-Fluoro-2-nitrobenzoic Acid, >98.0%(GC)(T), 2-Fluoro-6-nitrobenzoic acid 97%, 2-Fluoro-6-nitrobenzoic acid, 95%+, 95%+. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
2-fluoro-6-nitrobenzoic acid (CAS 385-02-4) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 2-fluoro-6-nitrobenzoic acid. InChIKey: MPDZCNPDHUUPRL-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 2-fluoro-6-nitrobenzoic acid |
| InChIKey | MPDZCNPDHUUPRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)