Products 7304-32-7
CAS 7304-32-7 appears in our catalog under these names: 2-Fluoro-5-nitrobenzoic Acid, 2–Fluoro–5–nitrobenzoic Acid, 2-Fluoro-5-nitrobenzoic acid, 98% , 2-Fluoro-5-nitrobenzoic Acid, >98.0%(GC)(T), 2-Fluoro-5-nitrobenzoic acid 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 500g, 1kg, 5kg.
2-fluoro-5-nitrobenzoic acid (CAS 7304-32-7) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 2-fluoro-5-nitrobenzoic acid. InChIKey: ICXSHFWYCHJILC-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 2-fluoro-5-nitrobenzoic acid |
| InChIKey | ICXSHFWYCHJILC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)F |
Computed by PubChem (NCBI)