CAS 394-01-4 appears in our catalog under these names: 4–Fluoro–2–nitrobenzoic acid, 4-Fluoro-2-nitrobenzoic acid, 98%, 4-Fluoro-2-nitrobenzoic acid 97%, 4-Fluoro-2-nitrobenzoic Acid, >98.0%(GC), 4-Fluoro-2-nitrobenzoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, TCI. Available pack sizes: 100g, 5g, 25g, 10g, 500g, 1g.
4-fluoro-2-nitrobenzoic acid (CAS 394-01-4) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 4-fluoro-2-nitrobenzoic acid. InChIKey: YLUCXHMYRQUERW-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 4-fluoro-2-nitrobenzoic acid |
| InChIKey | YLUCXHMYRQUERW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)