Products 14027-75-9
CAS 14027-75-9 appears in our catalog under these names: 3-Fluoro-5-nitrobenzoic acid, 97%, 3–Fluoro–5–nitrobenzoic acid, 3-Fluoro-5-nitrobenzoic acid 98%, 3-Fluoro-5-nitrobenzoic acid, 98%, 98%, 3-Fluoro-5-nitrobenzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
3-fluoro-5-nitrobenzoic acid (CAS 14027-75-9) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 3-fluoro-5-nitrobenzoic acid. InChIKey: VIPUIECMSDQUIK-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 3-fluoro-5-nitrobenzoic acid |
| InChIKey | VIPUIECMSDQUIK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)