cas: 1195945-65-3 — see every product listed under this CAS number, including other names
3-Fluoro-5-isopropoxyphenylboronic acid, 97%, 97% (CAS 1195945-65-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HF2L-250mg |
| cas | 1195945-65-3 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 25g | 1288.40 Pln | |
| Chemat | 100mg | 107.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-fluoro-5-propan-2-yloxyphenyl)boronic acid (CAS 1195945-65-3) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (3-fluoro-5-propan-2-yloxyphenyl)boronic acid. InChIKey: HJJYROZZJOJOOW-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (3-fluoro-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | HJJYROZZJOJOOW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)OC(C)C)(O)O |
Computed by PubChem (NCBI)