cas: 454-73-9 — see every product listed under this CAS number, including other names
3-Fluoro-5-nitro-1-trifluoromethylbenzene, 95% (CAS 454-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079784-250MG |
| cas | 454-73-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 315.53 Pln | |
| Fluorochem | 25g | 685.19 Pln | |
| Fluorochem | 50g | 1294.35 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-fluoro-3-nitro-5-(trifluoromethyl)benzene (CAS 454-73-9) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-3-nitro-5-(trifluoromethyl)benzene. InChIKey: RKLBCPTURHSIOJ-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-3-nitro-5-(trifluoromethyl)benzene |
| InChIKey | RKLBCPTURHSIOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])F)C(F)(F)F |
Computed by PubChem (NCBI)