cas: 480424-49-5 — see every product listed under this CAS number, including other names
3-Formyl-2-methoxyphenylboronic acid, 95% (CAS 480424-49-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F225332-1G |
| cas | 480424-49-5 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 555.03 Pln | |
| Fluorochem | 25g | 1278.73 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 25g | 1182.50 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(3-formyl-2-methoxyphenyl)boronic acid (CAS 480424-49-5) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: (3-formyl-2-methoxyphenyl)boronic acid. InChIKey: DUROSIJIMLRFHR-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | (3-formyl-2-methoxyphenyl)boronic acid |
| InChIKey | DUROSIJIMLRFHR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C=O)OC)(O)O |
Computed by PubChem (NCBI)