cas: 135-61-5 — see every product listed under this CAS number, including other names
3-Hydroxy-2'-methyl-2-naphthanilide, >97.0%(HPLC) (CAS 135-61-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H0315-25G |
| cas | 135-61-5 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 498.46 Pln | |
| TCI | 500g | 4329.00 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC) |
3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide (CAS 135-61-5) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide. InChIKey: FBLAHUMENIHUGG-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide |
| InChIKey | FBLAHUMENIHUGG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C=C2O |
Computed by PubChem (NCBI)