cas: 135-61-5 — see every product listed under this CAS number, including other names
NSC-37188 98% HPLC (CAS 135-61-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105280-100g |
| cas | 135-61-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 170.12 Pln | |
| Ambeed | 500g | 381.50 Pln | |
| Ambeed | 1000g | 587.31 Pln |
| purity | 98% HPLC |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A105280 |
3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide (CAS 135-61-5) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide. InChIKey: FBLAHUMENIHUGG-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide |
| InChIKey | FBLAHUMENIHUGG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C=C2O |
Computed by PubChem (NCBI)