cas: 6889-78-7 — see every product listed under this CAS number, including other names
3-Hydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one, 98%, 98% (CAS 6889-78-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JJR-25g |
| cas | 6889-78-7 |
| size | 25g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 3040.40 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 654.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-2-(4-methoxyphenyl)chromen-4-one (CAS 6889-78-7) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: IIBBFGMVMNZMGA-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | IIBBFGMVMNZMGA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)