cas: 6889-78-7 — see every product listed under this CAS number, including other names
3-Hydroxy-4'-methoxyflavone, >98.0%(HPLC) (CAS 6889-78-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H1405-1G |
| cas | 6889-78-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 388.79 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
3-hydroxy-2-(4-methoxyphenyl)chromen-4-one (CAS 6889-78-7) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: IIBBFGMVMNZMGA-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | IIBBFGMVMNZMGA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)