cas: 619-14-7 — see every product listed under this CAS number, including other names
3-Hydroxy-4-nitro-benzoic acid, 97% (CAS 619-14-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036400-25G |
| cas | 619-14-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 169.75 Pln | |
| Fluorochem | 500g | 627.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-hydroxy-4-nitrobenzoic acid (CAS 619-14-7) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-4-nitrobenzoic acid. InChIKey: XLDLRRGZWIEEHT-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-4-nitrobenzoic acid |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)