cas: 619-14-7 — see every product listed under this CAS number, including other names
3-Hydroxy-4-nitrobenzoic acid, 99.71% (CAS 619-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 500 g, 25 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-69341-100 g |
| cas | 619-14-7 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 384.71 Pln | |
| MedChemExpress | 500 g | 765.52 Pln | |
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 50 g | 287.18 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.71% |
3-hydroxy-4-nitrobenzoic acid (CAS 619-14-7) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-4-nitrobenzoic acid. InChIKey: XLDLRRGZWIEEHT-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-4-nitrobenzoic acid |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)