cas: 619-14-7 — see every product listed under this CAS number, including other names
3-Hydroxy-4-nitrobenzoic acid, 98%, 98% (CAS 619-14-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 50kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JJY-5g |
| cas | 619-14-7 |
| size | 5g |
| availability | 50000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 98.00 Pln | |
| Chemat | 100g | 131.60 Pln | |
| Chemat | 250g | 237.20 Pln | |
| Chemat | 50kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-4-nitrobenzoic acid (CAS 619-14-7) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-4-nitrobenzoic acid. InChIKey: XLDLRRGZWIEEHT-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-4-nitrobenzoic acid |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)