cas: 78238-14-9 — see every product listed under this CAS number, including other names
3-Hydroxy-5-nitrobenzoic acid 97% (CAS 78238-14-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A813663-1g |
| cas | 78238-14-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 25g | 854.31 Pln | |
| Ambeed | 100g | 2951.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A813663 |
3-hydroxy-5-nitrobenzoic acid (CAS 78238-14-9) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-5-nitrobenzoic acid. InChIKey: ZVLLYIMPDTXFNC-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-5-nitrobenzoic acid |
| InChIKey | ZVLLYIMPDTXFNC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])O)C(=O)O |
Computed by PubChem (NCBI)