cas: 1360963-23-0 — see every product listed under this CAS number, including other names
3-IODO-6-NITRO-1H-INDOLE, 97%, 97% (CAS 1360963-23-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUGU-100mg |
| cas | 1360963-23-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 500mg | 342.80 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1178.00 Pln | |
| Chemat | 10g | 1917.20 Pln | |
| Chemat | 25g | 3774.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-iodo-6-nitro-1H-indole (CAS 1360963-23-0) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 3-iodo-6-nitro-1H-indole. InChIKey: VWYMWFCKFDGAFF-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-iodo-6-nitro-1H-indole |
| InChIKey | VWYMWFCKFDGAFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC=C2I |
Computed by PubChem (NCBI)