3-Indolepropionic acid, 97%
cas: 830-96-6 — see every product listed under this CAS number, including other names
3-Indolepropionic acid, 97% (CAS 830-96-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078646-1G |
| cas | 830-96-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 112.48 Pln | |
| Fluorochem | 100g | 237.43 Pln | |
| Fluorochem | 500g | 549.82 Pln | |
| Fluorochem | 1kg | 1044.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3-(1H-indol-3-yl)propanoic acid is an indol-3-yl carboxylic acid that is propionic acid substituted by a 1H-indol-3-yl group at position 3. It has a role as an auxin, a plant metabolite and a human metabolite. It is functionally related to a propionic acid. It is a conjugate acid of a 3-(1H-indol-3-yl)propanoate.
Source: ChEBI
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)propanoic acid |
| InChIKey | GOLXRNDWAUTYKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCC(=O)O |
Computed by PubChem (NCBI)