3-Indolepropionic acid, 98%, 98%
cas: 830-96-6 — see every product listed under this CAS number, including other names
3-Indolepropionic acid, 98%, 98% (CAS 830-96-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg, 5kg, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144QE-5g |
| cas | 830-96-6 |
| size | 5g |
| availability | 25000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 165.20 Pln | |
| Chemat | 500g | 576.00 Pln | |
| Chemat | 1kg | 1067.60 Pln | |
| Chemat | 5kg | 4449.60 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(1H-indol-3-yl)propanoic acid is an indol-3-yl carboxylic acid that is propionic acid substituted by a 1H-indol-3-yl group at position 3. It has a role as an auxin, a plant metabolite and a human metabolite. It is functionally related to a propionic acid. It is a conjugate acid of a 3-(1H-indol-3-yl)propanoate.
Source: ChEBI
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)propanoic acid |
| InChIKey | GOLXRNDWAUTYKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCC(=O)O |
Computed by PubChem (NCBI)